CAS 2088914-60-5 is the registry number for Enzalutamide Impurity 51. Offered by: Chemat Brand. Available pack sizes: on request.
O-propan-2-yl N-[4-cyano-3-(trifluoromethyl)phenyl]carbamothioate (CAS 2088914-60-5) is a chemical compound with the molecular formula C12H11F3N2OS and a molecular weight of 288.29 g/mol. IUPAC name: O-propan-2-yl N-[4-cyano-3-(trifluoromethyl)phenyl]carbamothioate. InChIKey: LYTBMSXMYFEBOA-UHFFFAOYSA-N.
| Molecular formula | C12H11F3N2OS |
|---|---|
| Molecular weight | 288.29 g/mol |
| IUPAC name | O-propan-2-yl N-[4-cyano-3-(trifluoromethyl)phenyl]carbamothioate |
| InChIKey | LYTBMSXMYFEBOA-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=S)NC1=CC(=C(C=C1)C#N)C(F)(F)F |
Computed by PubChem (NCBI)