CAS 2088974-26-7 is the registry number for Rel-(1R,5S,8s)-3-(3-methylisothiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,5R)-3-(3-methyl-1,2-thiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-amine (CAS 2088974-26-7) is a chemical compound with the molecular formula C11H17N3S and a molecular weight of 223.34 g/mol. IUPAC name: (1S,5R)-3-(3-methyl-1,2-thiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-amine. InChIKey: ZSFDJQQUZDIPTM-SLHIUPAKSA-N.
| Molecular formula | C11H17N3S |
|---|---|
| Molecular weight | 223.34 g/mol |
| IUPAC name | (1S,5R)-3-(3-methyl-1,2-thiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-amine |
| InChIKey | ZSFDJQQUZDIPTM-SLHIUPAKSA-N |
| SMILES | CC1=NSC(=C1)N2C[C@H]3CC[C@@H](C2)C3N |
Computed by PubChem (NCBI)