CAS 2089040-93-5 is the registry number for URAT1&XO inhibitor 3. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(5-cyano-2-fluoro-1-benzofuran-7-yl)-2-hydroxybenzoic acid (CAS 2089040-93-5) is a chemical compound with the molecular formula C16H8FNO4 and a molecular weight of 297.24 g/mol. IUPAC name: 4-(5-cyano-2-fluoro-1-benzofuran-7-yl)-2-hydroxybenzoic acid. InChIKey: VBWLCOGQAODFLX-UHFFFAOYSA-N.
| Molecular formula | C16H8FNO4 |
|---|---|
| Molecular weight | 297.24 g/mol |
| IUPAC name | 4-(5-cyano-2-fluoro-1-benzofuran-7-yl)-2-hydroxybenzoic acid |
| InChIKey | VBWLCOGQAODFLX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC(=CC3=C2OC(=C3)F)C#N)O)C(=O)O |
Computed by PubChem (NCBI)