Products 2089040-93-5

CAS 2089040-93-5 is the registry number for URAT1&XO inhibitor 3. Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

4-(5-cyano-2-fluoro-1-benzofuran-7-yl)-2-hydroxybenzoic acid (CAS 2089040-93-5) is a chemical compound with the molecular formula C16H8FNO4 and a molecular weight of 297.24 g/mol. IUPAC name: 4-(5-cyano-2-fluoro-1-benzofuran-7-yl)-2-hydroxybenzoic acid. InChIKey: VBWLCOGQAODFLX-UHFFFAOYSA-N.

Identity
Molecular formulaC16H8FNO4
Molecular weight297.24 g/mol
IUPAC name4-(5-cyano-2-fluoro-1-benzofuran-7-yl)-2-hydroxybenzoic acid
InChIKeyVBWLCOGQAODFLX-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C2=CC(=CC3=C2OC(=C3)F)C#N)O)C(=O)O

Computed by PubChem (NCBI)

Synonyms: orb2665428