CAS 2089150-84-3 is the registry number for 4-Carboxy-1-(3,5-dicarboxybenzyl)pyridin-1-ium bromide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[(4-carboxypyridin-1-ium-1-yl)methyl]benzene-1,3-dicarboxylic acid bromide (CAS 2089150-84-3) is a chemical compound with the molecular formula C15H12BrNO6 and a molecular weight of 382.16 g/mol. IUPAC name: 5-[(4-carboxypyridin-1-ium-1-yl)methyl]benzene-1,3-dicarboxylic acid bromide. InChIKey: DGAIELPRXMXTHU-UHFFFAOYSA-N.
| Molecular formula | C15H12BrNO6 |
|---|---|
| Molecular weight | 382.16 g/mol |
| IUPAC name | 5-[(4-carboxypyridin-1-ium-1-yl)methyl]benzene-1,3-dicarboxylic acid bromide |
| InChIKey | DGAIELPRXMXTHU-UHFFFAOYSA-N |
| SMILES | C1=C[N+](=CC=C1C(=O)O)CC2=CC(=CC(=C2)C(=O)O)C(=O)O.[Br-] |
Computed by PubChem (NCBI)