CAS 2089245-73-6 is the registry number for 2-Methyl-2-((2S,6R)-6-(trifluoromethyl)piperidin-2-yl)propanoic acid, 98%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
2-methyl-2-[(2S,6R)-6-(trifluoromethyl)piperidin-2-yl]propanoic acid (CAS 2089245-73-6) is a chemical compound with the molecular formula C10H16F3NO2 and a molecular weight of 239.23 g/mol. IUPAC name: 2-methyl-2-[(2S,6R)-6-(trifluoromethyl)piperidin-2-yl]propanoic acid. InChIKey: GAMVXVPTIGEJHW-NKWVEPMBSA-N.
| Molecular formula | C10H16F3NO2 |
|---|---|
| Molecular weight | 239.23 g/mol |
| IUPAC name | 2-methyl-2-[(2S,6R)-6-(trifluoromethyl)piperidin-2-yl]propanoic acid |
| InChIKey | GAMVXVPTIGEJHW-NKWVEPMBSA-N |
| SMILES | CC(C)([C@@H]1CCC[C@@H](N1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)