CAS 2089245-91-8 appears in our catalog under these names: Methyl (2R)-5-oxo-1-(propan-2-yl)pyrrolidine-2-carboxylate, 95%, Methyl (2R)-5-oxo-1-(propan-2-yl)pyrrolidine-2-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Methyl (2R)-5-oxo-1-propan-2-ylpyrrolidine-2-carboxylate (CAS 2089245-91-8) is a chemical compound with the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. IUPAC name: methyl (2R)-5-oxo-1-propan-2-ylpyrrolidine-2-carboxylate. InChIKey: HBRMNPXGFMAHRX-SSDOTTSWSA-N.
| Molecular formula | C9H15NO3 |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | methyl (2R)-5-oxo-1-propan-2-ylpyrrolidine-2-carboxylate |
| InChIKey | HBRMNPXGFMAHRX-SSDOTTSWSA-N |
| SMILES | CC(C)N1[C@H](CCC1=O)C(=O)OC |
Computed by PubChem (NCBI)