Products 2089254-99-7

CAS 2089254-99-7 is the registry number for tert-Butyl N-(4-(2-hydroxyethyl)thian-4-yl)carbamate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-[4-(2-hydroxyethyl)thian-4-yl]carbamate (CAS 2089254-99-7) is a chemical compound with the molecular formula C12H23NO3S and a molecular weight of 261.38 g/mol. IUPAC name: tert-butyl N-[4-(2-hydroxyethyl)thian-4-yl]carbamate. InChIKey: CPZLGORELOMWQM-UHFFFAOYSA-N.

Identity
Molecular formulaC12H23NO3S
Molecular weight261.38 g/mol
IUPAC nametert-butyl N-[4-(2-hydroxyethyl)thian-4-yl]carbamate
InChIKeyCPZLGORELOMWQM-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1(CCSCC1)CCO

Computed by PubChem (NCBI)