CAS 2089257-35-0 is the registry number for Lithium(1+) ion 2-{2-((2-methylcyclopropyl)amino)-1,3-thiazol-4-yl}acetate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Lithium 2-[2-[(2-methylcyclopropyl)amino]-1,3-thiazol-4-yl]acetate (CAS 2089257-35-0) is a chemical compound with the molecular formula C9H11LiN2O2S and a molecular weight of 218.2 g/mol. IUPAC name: lithium 2-[2-[(2-methylcyclopropyl)amino]-1,3-thiazol-4-yl]acetate. InChIKey: RKKMYCLOPNEYAI-UHFFFAOYSA-M.
| Molecular formula | C9H11LiN2O2S |
|---|---|
| Molecular weight | 218.2 g/mol |
| IUPAC name | lithium 2-[2-[(2-methylcyclopropyl)amino]-1,3-thiazol-4-yl]acetate |
| InChIKey | RKKMYCLOPNEYAI-UHFFFAOYSA-M |
| SMILES | [Li+].CC1CC1NC2=NC(=CS2)CC(=O)[O-] |
Computed by PubChem (NCBI)