Products 2089257-43-0

CAS 2089257-43-0 is the registry number for 4-(Bromomethyl)-1,3,5-trimethyl-1h-pyrazole hydrobromide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

4-(bromomethyl)-1,3,5-trimethylpyrazole;hydrobromide (CAS 2089257-43-0) is a chemical compound with the molecular formula C7H12Br2N2 and a molecular weight of 283.99 g/mol. IUPAC name: 4-(bromomethyl)-1,3,5-trimethylpyrazole;hydrobromide. InChIKey: WGZHMOZOHNJDHL-UHFFFAOYSA-N.

Identity
Molecular formulaC7H12Br2N2
Molecular weight283.99 g/mol
IUPAC name4-(bromomethyl)-1,3,5-trimethylpyrazole;hydrobromide
InChIKeyWGZHMOZOHNJDHL-UHFFFAOYSA-N
SMILESCC1=C(C(=NN1C)C)CBr.Br

Computed by PubChem (NCBI)