CAS 2089258-03-5 appears in our catalog under these names: 1,3-Dichloro-6-fluoro-7-methoxyisoquinoline, 95%, 1,3-Dichloro-6-fluoro-7-methoxyisoquinoline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1,3-dichloro-6-fluoro-7-methoxyisoquinoline (CAS 2089258-03-5) is a chemical compound with the molecular formula C10H6Cl2FNO and a molecular weight of 246.06 g/mol. IUPAC name: 1,3-dichloro-6-fluoro-7-methoxyisoquinoline. InChIKey: IEQQEFVARMURER-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2FNO |
|---|---|
| Molecular weight | 246.06 g/mol |
| IUPAC name | 1,3-dichloro-6-fluoro-7-methoxyisoquinoline |
| InChIKey | IEQQEFVARMURER-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C=C(N=C(C2=C1)Cl)Cl)F |
Computed by PubChem (NCBI)