CAS 2089277-69-8 appears in our catalog under these names: Lithium(1+) ion 5-hydroxy-2,2-dimethylpentanoate, 95%, 5-hydroxy-2,2-dimethylpentanoate lithium. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Lithium 5-hydroxy-2,2-dimethylpentanoate (CAS 2089277-69-8) is a chemical compound with the molecular formula C7H13LiO3 and a molecular weight of 152.1 g/mol. IUPAC name: lithium 5-hydroxy-2,2-dimethylpentanoate. InChIKey: GKMUWPRHGXIIHS-UHFFFAOYSA-M.
| Molecular formula | C7H13LiO3 |
|---|---|
| Molecular weight | 152.1 g/mol |
| IUPAC name | lithium 5-hydroxy-2,2-dimethylpentanoate |
| InChIKey | GKMUWPRHGXIIHS-UHFFFAOYSA-M |
| SMILES | [Li+].CC(C)(CCCO)C(=O)[O-] |
Computed by PubChem (NCBI)