CAS 2089291-55-2 is the registry number for 3-Bromo-5,6-dichloropyrazin-2-amine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-5,6-dichloropyrazin-2-amine (CAS 2089291-55-2) is a chemical compound with the molecular formula C4H2BrCl2N3 and a molecular weight of 242.89 g/mol. IUPAC name: 3-bromo-5,6-dichloropyrazin-2-amine. InChIKey: CYVNXIUGQQCPOC-UHFFFAOYSA-N.
| Molecular formula | C4H2BrCl2N3 |
|---|---|
| Molecular weight | 242.89 g/mol |
| IUPAC name | 3-bromo-5,6-dichloropyrazin-2-amine |
| InChIKey | CYVNXIUGQQCPOC-UHFFFAOYSA-N |
| SMILES | C1(=C(N=C(C(=N1)Cl)Cl)Br)N |
Computed by PubChem (NCBI)