CAS 2089291-70-1 appears in our catalog under these names: Exo-3-azabicyclo[3.2.1]octan-8-ol hydrochloride, 95%, (8-anti)-3-Azabicyclo(3.2.1)octan-8-ol hydrochloride, 97%, (8-anti)-3-Azabicyclo[3.2.1]octan-8-ol hydrochloride, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 250mg, 5g, 10g, 100mg.
(1R,5S)-3-azabicyclo[3.2.1]octan-8-ol;hydrochloride (CAS 2089291-70-1) is a chemical compound with the molecular formula C7H14ClNO and a molecular weight of 163.64 g/mol. IUPAC name: (1R,5S)-3-azabicyclo[3.2.1]octan-8-ol;hydrochloride. InChIKey: YCMFHKGTJWAZSH-VPEOJXMDSA-N.
| Molecular formula | C7H14ClNO |
|---|---|
| Molecular weight | 163.64 g/mol |
| IUPAC name | (1R,5S)-3-azabicyclo[3.2.1]octan-8-ol;hydrochloride |
| InChIKey | YCMFHKGTJWAZSH-VPEOJXMDSA-N |
| SMILES | C1C[C@H]2CNC[C@@H]1C2O.Cl |
Computed by PubChem (NCBI)