CAS 2089311-22-6 appears in our catalog under these names: 5,6–Dichloro–3–iodopyrazin–2–amine, 5,6-Dichloro-3-iodopyrazin-2-amine 95%. Offered by: GLPBio, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
5,6-dichloro-3-iodopyrazin-2-amine (CAS 2089311-22-6) is a chemical compound with the molecular formula C4H2Cl2IN3 and a molecular weight of 289.89 g/mol. IUPAC name: 5,6-dichloro-3-iodopyrazin-2-amine. InChIKey: HTQIBHPEVIOGGS-UHFFFAOYSA-N.
| Molecular formula | C4H2Cl2IN3 |
|---|---|
| Molecular weight | 289.89 g/mol |
| IUPAC name | 5,6-dichloro-3-iodopyrazin-2-amine |
| InChIKey | HTQIBHPEVIOGGS-UHFFFAOYSA-N |
| SMILES | C1(=C(N=C(C(=N1)Cl)Cl)I)N |
Computed by PubChem (NCBI)