CAS 2089315-56-8 appears in our catalog under these names: 7-Iodo-2,3-dimethyl-5H-pyrrolo(2,3-b)pyrazine, 97%, 7-iodo-2,3-dimethyl-5H-pyrrolo[2,3-b]pyrazine, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg.
7-iodo-2,3-dimethyl-5H-pyrrolo[2,3-b]pyrazine (CAS 2089315-56-8) is a chemical compound with the molecular formula C8H8IN3 and a molecular weight of 273.07 g/mol. IUPAC name: 7-iodo-2,3-dimethyl-5H-pyrrolo[2,3-b]pyrazine. InChIKey: CHNKIVOGGCWYRC-UHFFFAOYSA-N.
| Molecular formula | C8H8IN3 |
|---|---|
| Molecular weight | 273.07 g/mol |
| IUPAC name | 7-iodo-2,3-dimethyl-5H-pyrrolo[2,3-b]pyrazine |
| InChIKey | CHNKIVOGGCWYRC-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C2C(=N1)C(=CN2)I)C |
Computed by PubChem (NCBI)