CAS 2089316-08-3 appears in our catalog under these names: (2-(Trifluoromethyl)thiazol-4-yl)methanamine hydrochloride, 98%, (2-(Trifluoromethyl)-1,3-thiazol-4-yl)methanamine hydrochloride, (2-(Trifluoromethyl)thiazol-4-yl)methanamine hydrochloride, 95%, (2-(TRIFLUOROMETHYL)THIAZOL-4-YL)METHANAMINE HCL, 95%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 0,5g, 50mg, 100mg, 250mg.
[2-(trifluoromethyl)-1,3-thiazol-4-yl]methanamine;hydrochloride (CAS 2089316-08-3) is a chemical compound with the molecular formula C5H6ClF3N2S and a molecular weight of 218.63 g/mol. IUPAC name: [2-(trifluoromethyl)-1,3-thiazol-4-yl]methanamine;hydrochloride. InChIKey: LBBXKHNHGYMCGU-UHFFFAOYSA-N.
| Molecular formula | C5H6ClF3N2S |
|---|---|
| Molecular weight | 218.63 g/mol |
| IUPAC name | [2-(trifluoromethyl)-1,3-thiazol-4-yl]methanamine;hydrochloride |
| InChIKey | LBBXKHNHGYMCGU-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(S1)C(F)(F)F)CN.Cl |
Computed by PubChem (NCBI)