CAS 2089332-67-0 is the registry number for Hexamethylenimine-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 500mg, Get quote.
2,2,7,7-tetradeuterioazepane (CAS 2089332-67-0) is a chemical compound with the molecular formula C6H13N and a molecular weight of 103.20 g/mol. IUPAC name: 2,2,7,7-tetradeuterioazepane. InChIKey: ZSIQJIWKELUFRJ-NZLXMSDQSA-N.
| Molecular formula | C6H13N |
|---|---|
| Molecular weight | 103.20 g/mol |
| IUPAC name | 2,2,7,7-tetradeuterioazepane |
| InChIKey | ZSIQJIWKELUFRJ-NZLXMSDQSA-N |
| SMILES | [2H]C1(CCCCC(N1)([2H])[2H])[2H] |
Computed by PubChem (NCBI)