Products 2089381-43-9
CAS 2089381-43-9 is the registry number for 5-Fluoro-1H-pyrrolo(2,3-b)pyridin-3-amine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-amine;hydrochloride (CAS 2089381-43-9) is a chemical compound with the molecular formula C7H7ClFN3 and a molecular weight of 187.60 g/mol. IUPAC name: 5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-amine;hydrochloride. InChIKey: RQQJVNWMGNHQML-UHFFFAOYSA-N.
| Molecular formula | C7H7ClFN3 |
|---|---|
| Molecular weight | 187.60 g/mol |
| IUPAC name | 5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-amine;hydrochloride |
| InChIKey | RQQJVNWMGNHQML-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1C(=CN2)N)F.Cl |
Computed by PubChem (NCBI)