Products 2089390-09-8
CAS 2089390-09-8 is the registry number for Zavabresib. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg, 25 mg, 50 mg.
4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(1,1-dipyridin-2-ylethyl)pyrrolo[3,2-b]pyridin-3-yl]benzoic acid (CAS 2089390-09-8) is a chemical compound with the molecular formula C31H25N5O3 and a molecular weight of 515.6 g/mol. IUPAC name: 4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(1,1-dipyridin-2-ylethyl)pyrrolo[3,2-b]pyridin-3-yl]benzoic acid. InChIKey: LLUTURRCWNCHPC-UHFFFAOYSA-N.
| Molecular formula | C31H25N5O3 |
|---|---|
| Molecular weight | 515.6 g/mol |
| IUPAC name | 4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(1,1-dipyridin-2-ylethyl)pyrrolo[3,2-b]pyridin-3-yl]benzoic acid |
| InChIKey | LLUTURRCWNCHPC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)C2=CC3=C(C(=CN3C(C)(C4=CC=CC=N4)C5=CC=CC=N5)C6=CC=C(C=C6)C(=O)O)N=C2 |
Computed by PubChem (NCBI)