CAS 208941-96-2 appears in our catalog under these names: Rizatriptan EP Impurity C, Rizatriptan Impurity 3(Rizatriptan EP Impurity C), Iso Rizatriptan, >95% (HPLC), IsoRizatriptan. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 2mg.
N,N-dimethyl-2-[5-(1,2,4-triazol-1-ylmethyl)-1H-indol-2-yl]ethanamine (CAS 208941-96-2) is a chemical compound with the molecular formula C15H19N5 and a molecular weight of 269.34 g/mol. IUPAC name: N,N-dimethyl-2-[5-(1,2,4-triazol-1-ylmethyl)-1H-indol-2-yl]ethanamine. InChIKey: ABKUUFDCAHYSCG-UHFFFAOYSA-N.
| Molecular formula | C15H19N5 |
|---|---|
| Molecular weight | 269.34 g/mol |
| IUPAC name | N,N-dimethyl-2-[5-(1,2,4-triazol-1-ylmethyl)-1H-indol-2-yl]ethanamine |
| InChIKey | ABKUUFDCAHYSCG-UHFFFAOYSA-N |
| SMILES | CN(C)CCC1=CC2=C(N1)C=CC(=C2)CN3C=NC=N3 |
Computed by PubChem (NCBI)