CAS 2089642-09-9 appears in our catalog under these names: (E)-N'-(6-Bromopicolinoyl)-n,n-dimethylformohydrazonamide, 95%, (E)-N'-(6-Bromopicolinoyl)-N,N-dimethylformohydrazonamide, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
6-bromo-N-[(E)-dimethylaminomethylideneamino]pyridine-2-carboxamide (CAS 2089642-09-9) is a chemical compound with the molecular formula C9H11BrN4O and a molecular weight of 271.11 g/mol. IUPAC name: 6-bromo-N-[(E)-dimethylaminomethylideneamino]pyridine-2-carboxamide. InChIKey: ZECIQTNFCLSJLP-IZZDOVSWSA-N.
| Molecular formula | C9H11BrN4O |
|---|---|
| Molecular weight | 271.11 g/mol |
| IUPAC name | 6-bromo-N-[(E)-dimethylaminomethylideneamino]pyridine-2-carboxamide |
| InChIKey | ZECIQTNFCLSJLP-IZZDOVSWSA-N |
| SMILES | CN(C)/C=N/NC(=O)C1=NC(=CC=C1)Br |
Computed by PubChem (NCBI)