CAS 2089648-86-0 is the registry number for METHYL 1-(3-IODOPHENYL)CYCLOPROPANE-1-CARBOXYLATE, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl 1-(3-iodophenyl)cyclopropane-1-carboxylate (CAS 2089648-86-0) is a chemical compound with the molecular formula C11H11IO2 and a molecular weight of 302.11 g/mol. IUPAC name: methyl 1-(3-iodophenyl)cyclopropane-1-carboxylate. InChIKey: BFDIXXQMORRULH-UHFFFAOYSA-N.
| Molecular formula | C11H11IO2 |
|---|---|
| Molecular weight | 302.11 g/mol |
| IUPAC name | methyl 1-(3-iodophenyl)cyclopropane-1-carboxylate |
| InChIKey | BFDIXXQMORRULH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(CC1)C2=CC(=CC=C2)I |
Computed by PubChem (NCBI)