CAS 1094416-86-0 is the registry number for 2-(4-Iodobenzoyl)oxolane. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(4-iodophenyl)-(oxolan-2-yl)methanone (CAS 1094416-86-0) is a chemical compound with the molecular formula C11H11IO2 and a molecular weight of 302.11 g/mol. IUPAC name: (4-iodophenyl)-(oxolan-2-yl)methanone. InChIKey: NIGUUNWVSSBRBS-UHFFFAOYSA-N.
| Molecular formula | C11H11IO2 |
|---|---|
| Molecular weight | 302.11 g/mol |
| IUPAC name | (4-iodophenyl)-(oxolan-2-yl)methanone |
| InChIKey | NIGUUNWVSSBRBS-UHFFFAOYSA-N |
| SMILES | C1CC(OC1)C(=O)C2=CC=C(C=C2)I |
Computed by PubChem (NCBI)