CAS 2090-82-6 is the registry number for Phenolphthaleindiphosphate, tetrasodium salt. Offered by: Chemat. Available pack sizes: 25g, 5g.
[4-[3-oxo-1-(4-phosphonooxyphenyl)-2-benzofuran-1-yl]phenyl] dihydrogen phosphate (CAS 2090-82-6) is a chemical compound with the molecular formula C20H16O10P2 and a molecular weight of 478.3 g/mol. IUPAC name: [4-[3-oxo-1-(4-phosphonooxyphenyl)-2-benzofuran-1-yl]phenyl] dihydrogen phosphate. InChIKey: WMDDNKROYKCDJC-UHFFFAOYSA-N.
| Molecular formula | C20H16O10P2 |
|---|---|
| Molecular weight | 478.3 g/mol |
| IUPAC name | [4-[3-oxo-1-(4-phosphonooxyphenyl)-2-benzofuran-1-yl]phenyl] dihydrogen phosphate |
| InChIKey | WMDDNKROYKCDJC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)OC2(C3=CC=C(C=C3)OP(=O)(O)O)C4=CC=C(C=C4)OP(=O)(O)O |
Computed by PubChem (NCBI)