Products 2090136-69-7

CAS 2090136-69-7 is the registry number for Methyl 5-hydroxyspiro(2.3)hexane-1-carboxylate. Offered by: Biosynth. Available pack sizes: 25mg, 10mg, 50mg, 100mg.

Structural formula: {0} (CAS {1})

Methyl 5-hydroxyspiro[2.3]hexane-2-carboxylate (CAS 2090136-69-7) is a chemical compound with the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. IUPAC name: methyl 5-hydroxyspiro[2.3]hexane-2-carboxylate. InChIKey: BFKGMKLRLZTVSZ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12O3
Molecular weight156.18 g/mol
IUPAC namemethyl 5-hydroxyspiro[2.3]hexane-2-carboxylate
InChIKeyBFKGMKLRLZTVSZ-UHFFFAOYSA-N
SMILESCOC(=O)C1CC12CC(C2)O

Computed by PubChem (NCBI)