CAS 2090303-92-5 is the registry number for 2,3,4-Trifluoro-5-sulfamoylbenzoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2,3,4-trifluoro-5-sulfamoylbenzoic acid (CAS 2090303-92-5) is a chemical compound with the molecular formula C7H4F3NO4S and a molecular weight of 255.17 g/mol. IUPAC name: 2,3,4-trifluoro-5-sulfamoylbenzoic acid. InChIKey: QQNGJNHKOKJXAH-UHFFFAOYSA-N.
| Molecular formula | C7H4F3NO4S |
|---|---|
| Molecular weight | 255.17 g/mol |
| IUPAC name | 2,3,4-trifluoro-5-sulfamoylbenzoic acid |
| InChIKey | QQNGJNHKOKJXAH-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1S(=O)(=O)N)F)F)F)C(=O)O |
Computed by PubChem (NCBI)