CAS 2090378-79-1 is the registry number for 4-Bromo-6-fluoro-1H-indazole-3-carbonitrile, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 100mg, 250mg.
4-bromo-6-fluoro-1H-indazole-3-carbonitrile (CAS 2090378-79-1) is a chemical compound with the molecular formula C8H3BrFN3 and a molecular weight of 240.03 g/mol. IUPAC name: 4-bromo-6-fluoro-1H-indazole-3-carbonitrile. InChIKey: XJXBWCZTZZBYLO-UHFFFAOYSA-N.
| Molecular formula | C8H3BrFN3 |
|---|---|
| Molecular weight | 240.03 g/mol |
| IUPAC name | 4-bromo-6-fluoro-1H-indazole-3-carbonitrile |
| InChIKey | XJXBWCZTZZBYLO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1NN=C2C#N)Br)F |
Computed by PubChem (NCBI)