CAS 2090498-07-8 appears in our catalog under these names: 4-Bromo-5-iodo-2-nitroaniline, 95%, 4-Bromo-5-iodo-2-nitroaniline. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 2g.
4-bromo-5-iodo-2-nitroaniline (CAS 2090498-07-8) is a chemical compound with the molecular formula C6H4BrIN2O2 and a molecular weight of 342.92 g/mol. IUPAC name: 4-bromo-5-iodo-2-nitroaniline. InChIKey: CBZXYNIGTCAUBQ-UHFFFAOYSA-N.
| Molecular formula | C6H4BrIN2O2 |
|---|---|
| Molecular weight | 342.92 g/mol |
| IUPAC name | 4-bromo-5-iodo-2-nitroaniline |
| InChIKey | CBZXYNIGTCAUBQ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1I)Br)[N+](=O)[O-])N |
Computed by PubChem (NCBI)