CAS 2090819-65-9 is the registry number for 4-Bromo-3-fluorobenzoyl cyanide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-3-fluorobenzoyl cyanide (CAS 2090819-65-9) is a chemical compound with the molecular formula C8H3BrFNO and a molecular weight of 228.02 g/mol. IUPAC name: 4-bromo-3-fluorobenzoyl cyanide. InChIKey: OASLETHUYLDBPE-UHFFFAOYSA-N.
| Molecular formula | C8H3BrFNO |
|---|---|
| Molecular weight | 228.02 g/mol |
| IUPAC name | 4-bromo-3-fluorobenzoyl cyanide |
| InChIKey | OASLETHUYLDBPE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)C#N)F)Br |
Computed by PubChem (NCBI)