Products 2090819-65-9

CAS 2090819-65-9 is the registry number for 4-Bromo-3-fluorobenzoyl cyanide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-bromo-3-fluorobenzoyl cyanide (CAS 2090819-65-9) is a chemical compound with the molecular formula C8H3BrFNO and a molecular weight of 228.02 g/mol. IUPAC name: 4-bromo-3-fluorobenzoyl cyanide. InChIKey: OASLETHUYLDBPE-UHFFFAOYSA-N.

Identity
Molecular formulaC8H3BrFNO
Molecular weight228.02 g/mol
IUPAC name4-bromo-3-fluorobenzoyl cyanide
InChIKeyOASLETHUYLDBPE-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C(=O)C#N)F)Br

Computed by PubChem (NCBI)