CAS 2090837-60-6 is the registry number for Rel-methyl (2S,5S)-5-(hydroxymethyl)pyrrolidine-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S,5S)-5-(hydroxymethyl)pyrrolidine-2-carboxylate (CAS 2090837-60-6) is a chemical compound with the molecular formula C7H13NO3 and a molecular weight of 159.18 g/mol. IUPAC name: methyl (2S,5S)-5-(hydroxymethyl)pyrrolidine-2-carboxylate. InChIKey: MVBWEDQLROJLNC-WDSKDSINSA-N.
| Molecular formula | C7H13NO3 |
|---|---|
| Molecular weight | 159.18 g/mol |
| IUPAC name | methyl (2S,5S)-5-(hydroxymethyl)pyrrolidine-2-carboxylate |
| InChIKey | MVBWEDQLROJLNC-WDSKDSINSA-N |
| SMILES | COC(=O)[C@@H]1CC[C@H](N1)CO |
Computed by PubChem (NCBI)