Products 2091146-38-0
CAS 2091146-38-0 is the registry number for 3-Bromo-2-chloro-6-fluorobenzotrifluoride. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
1-bromo-2-chloro-4-fluoro-3-(trifluoromethyl)benzene (CAS 2091146-38-0) is a chemical compound with the molecular formula C7H2BrClF4 and a molecular weight of 277.44 g/mol. IUPAC name: 1-bromo-2-chloro-4-fluoro-3-(trifluoromethyl)benzene. InChIKey: GBBYWLYGESLVGZ-UHFFFAOYSA-N.
| Molecular formula | C7H2BrClF4 |
|---|---|
| Molecular weight | 277.44 g/mol |
| IUPAC name | 1-bromo-2-chloro-4-fluoro-3-(trifluoromethyl)benzene |
| InChIKey | GBBYWLYGESLVGZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)C(F)(F)F)Cl)Br |
Computed by PubChem (NCBI)