Products 2091606-83-4
CAS 2091606-83-4 is the registry number for 2-Bromo-6-fluoro-3-(trifluoromethyl)benzonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-bromo-6-fluoro-3-(trifluoromethyl)benzonitrile (CAS 2091606-83-4) is a chemical compound with the molecular formula C8H2BrF4N and a molecular weight of 268.01 g/mol. IUPAC name: 2-bromo-6-fluoro-3-(trifluoromethyl)benzonitrile. InChIKey: MGYPGCILKULCQG-UHFFFAOYSA-N.
| Molecular formula | C8H2BrF4N |
|---|---|
| Molecular weight | 268.01 g/mol |
| IUPAC name | 2-bromo-6-fluoro-3-(trifluoromethyl)benzonitrile |
| InChIKey | MGYPGCILKULCQG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(F)(F)F)Br)C#N)F |
Computed by PubChem (NCBI)