Products 2091659-29-7
CAS 2091659-29-7 is the registry number for 3-(Methoxycarbonyl)-1,4-dimethyl-1H-pyrazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-methoxycarbonyl-1,4-dimethylpyrazole-5-carboxylic acid (CAS 2091659-29-7) is a chemical compound with the molecular formula C8H10N2O4 and a molecular weight of 198.18 g/mol. IUPAC name: 3-methoxycarbonyl-1,4-dimethylpyrazole-5-carboxylic acid. InChIKey: RHUDJXBNZIZQJT-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O4 |
|---|---|
| Molecular weight | 198.18 g/mol |
| IUPAC name | 3-methoxycarbonyl-1,4-dimethylpyrazole-5-carboxylic acid |
| InChIKey | RHUDJXBNZIZQJT-UHFFFAOYSA-N |
| SMILES | CC1=C(N(N=C1C(=O)OC)C)C(=O)O |
Computed by PubChem (NCBI)