Products 2091872-93-2
CAS 2091872-93-2 is the registry number for 5-Bromo-2-chloro-3-fluoropyridin-4-amine, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
5-bromo-2-chloro-3-fluoropyridin-4-amine (CAS 2091872-93-2) is a chemical compound with the molecular formula C5H3BrClFN2 and a molecular weight of 225.44 g/mol. IUPAC name: 5-bromo-2-chloro-3-fluoropyridin-4-amine. InChIKey: PJYXQFXKMYJPFD-UHFFFAOYSA-N.
| Molecular formula | C5H3BrClFN2 |
|---|---|
| Molecular weight | 225.44 g/mol |
| IUPAC name | 5-bromo-2-chloro-3-fluoropyridin-4-amine |
| InChIKey | PJYXQFXKMYJPFD-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)Cl)F)N)Br |
Computed by PubChem (NCBI)