CAS 2092048-46-7 is the registry number for 2-Bromo-5,5-dimethyl-4,5,6,7-tetrahydrobenzo[b]thiophen-4-amine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophen-4-amine (CAS 2092048-46-7) is a chemical compound with the molecular formula C10H14BrNS and a molecular weight of 260.20 g/mol. IUPAC name: 2-bromo-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophen-4-amine. InChIKey: ANFXFBIVDYYSJM-UHFFFAOYSA-N.
| Molecular formula | C10H14BrNS |
|---|---|
| Molecular weight | 260.20 g/mol |
| IUPAC name | 2-bromo-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophen-4-amine |
| InChIKey | ANFXFBIVDYYSJM-UHFFFAOYSA-N |
| SMILES | CC1(CCC2=C(C1N)C=C(S2)Br)C |
Computed by PubChem (NCBI)