Products 2092056-60-3

CAS 2092056-60-3 is the registry number for 4-Pyridazinecarbonitrile, 3,5-dichloro-, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.

Structural formula: {0} (CAS {1})

3,5-dichloropyridazine-4-carbonitrile (CAS 2092056-60-3) is a chemical compound with the molecular formula C5HCl2N3 and a molecular weight of 173.98 g/mol. IUPAC name: 3,5-dichloropyridazine-4-carbonitrile. InChIKey: RANMCAGXYOGJRV-UHFFFAOYSA-N.

Identity
Molecular formulaC5HCl2N3
Molecular weight173.98 g/mol
IUPAC name3,5-dichloropyridazine-4-carbonitrile
InChIKeyRANMCAGXYOGJRV-UHFFFAOYSA-N
SMILESC1=C(C(=C(N=N1)Cl)C#N)Cl

Computed by PubChem (NCBI)