Products 2092496-27-8

CAS 2092496-27-8 is the registry number for 4-Fluoro-1-methyl-1H-imidazole-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-fluoro-3-methylimidazole-4-carboxylic acid (CAS 2092496-27-8) is a chemical compound with the molecular formula C5H5FN2O2 and a molecular weight of 144.10 g/mol. IUPAC name: 5-fluoro-3-methylimidazole-4-carboxylic acid. InChIKey: YRRNBRSIKSOZDE-UHFFFAOYSA-N.

Identity
Molecular formulaC5H5FN2O2
Molecular weight144.10 g/mol
IUPAC name5-fluoro-3-methylimidazole-4-carboxylic acid
InChIKeyYRRNBRSIKSOZDE-UHFFFAOYSA-N
SMILESCN1C=NC(=C1C(=O)O)F

Computed by PubChem (NCBI)