CAS 2092515-15-4 is the registry number for tert-butyl trans-3,5-dihydroxypiperidine-1-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
Tert-butyl (3S,5S)-3,5-dihydroxypiperidine-1-carboxylate (CAS 2092515-15-4) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. IUPAC name: tert-butyl (3S,5S)-3,5-dihydroxypiperidine-1-carboxylate. InChIKey: KSUUHOYXJWSXIA-YUMQZZPRSA-N.
| Molecular formula | C10H19NO4 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | tert-butyl (3S,5S)-3,5-dihydroxypiperidine-1-carboxylate |
| InChIKey | KSUUHOYXJWSXIA-YUMQZZPRSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@@H](C1)O)O |
Computed by PubChem (NCBI)