Products 2092561-59-4

CAS 2092561-59-4 is the registry number for 4-Iodo-3-methyl-1H-pyrrole-2-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

4-iodo-3-methyl-1H-pyrrole-2-carboxylic acid (CAS 2092561-59-4) is a chemical compound with the molecular formula C6H6INO2 and a molecular weight of 251.02 g/mol. IUPAC name: 4-iodo-3-methyl-1H-pyrrole-2-carboxylic acid. InChIKey: PZOCJSMBVJCMAI-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6INO2
Molecular weight251.02 g/mol
IUPAC name4-iodo-3-methyl-1H-pyrrole-2-carboxylic acid
InChIKeyPZOCJSMBVJCMAI-UHFFFAOYSA-N
SMILESCC1=C(NC=C1I)C(=O)O

Computed by PubChem (NCBI)