CAS 20927-96-2 appears in our catalog under these names: Dibenzo(b,d)furan–2–carbonitrile, Dibenzo[b,d]furan-2-carbonitrile, 95%, dibenzo[b,d]furan-2-carbonitrile, 97%, Dibenzo[b,d]furan-2-carbonitrile, 95+%, Dibenzo[b,d]furan-2-carbonitrile, 95+%, 95+%. Offered by: GLPBio, Combi-blocks, Fluorochem, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g.
Dibenzofuran-2-carbonitrile (CAS 20927-96-2) is a chemical compound with the molecular formula C13H7NO and a molecular weight of 193.20 g/mol. IUPAC name: dibenzofuran-2-carbonitrile. InChIKey: JMLMVVOQPAPVOQ-UHFFFAOYSA-N.
| Molecular formula | C13H7NO |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | dibenzofuran-2-carbonitrile |
| InChIKey | JMLMVVOQPAPVOQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C=CC(=C3)C#N |
Computed by PubChem (NCBI)