Products 2092706-79-9
CAS 2092706-79-9 is the registry number for 6-Amino-3,3-dimethyl-3,4-dihydroisoquinolin-1(2h)-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
6-amino-3,3-dimethyl-2,4-dihydroisoquinolin-1-one (CAS 2092706-79-9) is a chemical compound with the molecular formula C11H14N2O and a molecular weight of 190.24 g/mol. IUPAC name: 6-amino-3,3-dimethyl-2,4-dihydroisoquinolin-1-one. InChIKey: NZERTMRWGCRTLX-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | 6-amino-3,3-dimethyl-2,4-dihydroisoquinolin-1-one |
| InChIKey | NZERTMRWGCRTLX-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(C=CC(=C2)N)C(=O)N1)C |
Computed by PubChem (NCBI)