CAS 2092726-85-5 is the registry number for Methyl 7-fluoro-4-hydroxy-2-naphthoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 7-fluoro-4-hydroxynaphthalene-2-carboxylate (CAS 2092726-85-5) is a chemical compound with the molecular formula C12H9FO3 and a molecular weight of 220.20 g/mol. IUPAC name: methyl 7-fluoro-4-hydroxynaphthalene-2-carboxylate. InChIKey: ZKKKDKNGWIRVFK-UHFFFAOYSA-N.
| Molecular formula | C12H9FO3 |
|---|---|
| Molecular weight | 220.20 g/mol |
| IUPAC name | methyl 7-fluoro-4-hydroxynaphthalene-2-carboxylate |
| InChIKey | ZKKKDKNGWIRVFK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C2C=CC(=CC2=C1)F)O |
Computed by PubChem (NCBI)