Products 2092815-18-2

CAS 2092815-18-2 is the registry number for 5-Oxa-2-thia-8-azaspiro[3.5]nonane 2,2-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-oxa-2lambda6-thia-8-azaspiro[3.5]nonane 2,2-dioxide (CAS 2092815-18-2) is a chemical compound with the molecular formula C6H11NO3S and a molecular weight of 177.22 g/mol. IUPAC name: 5-oxa-2lambda6-thia-8-azaspiro[3.5]nonane 2,2-dioxide. InChIKey: SLBAZEFPPUYBBV-UHFFFAOYSA-N.

Identity
Molecular formulaC6H11NO3S
Molecular weight177.22 g/mol
IUPAC name5-oxa-2lambda6-thia-8-azaspiro[3.5]nonane 2,2-dioxide
InChIKeySLBAZEFPPUYBBV-UHFFFAOYSA-N
SMILESC1COC2(CN1)CS(=O)(=O)C2

Computed by PubChem (NCBI)