Products 20929-30-0
CAS 20929-30-0 is the registry number for (3,5-bis(trifluoromethyl)phenyl)(4-methylpiperazin-1-yl)methanone, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
[3,5-bis(trifluoromethyl)phenyl]-(4-methylpiperazin-1-yl)methanone (CAS 20929-30-0) is a chemical compound with the molecular formula C14H14F6N2O and a molecular weight of 340.26 g/mol. IUPAC name: [3,5-bis(trifluoromethyl)phenyl]-(4-methylpiperazin-1-yl)methanone. InChIKey: LHODQMNKAFCVPE-UHFFFAOYSA-N.
| Molecular formula | C14H14F6N2O |
|---|---|
| Molecular weight | 340.26 g/mol |
| IUPAC name | [3,5-bis(trifluoromethyl)phenyl]-(4-methylpiperazin-1-yl)methanone |
| InChIKey | LHODQMNKAFCVPE-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C(=O)C2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)