Products 2092914-76-4
CAS 2092914-76-4 is the registry number for Dimethyl (2S,3S)–2–(benzyloxy)–3–((tert–butoxycarbonyl)amino)succinate. Offered by: GLPBio. Available pack sizes: 100mg.
Dimethyl (2S,3S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxybutanedioate (CAS 2092914-76-4) is a chemical compound with the molecular formula C18H25NO7 and a molecular weight of 367.4 g/mol. IUPAC name: dimethyl (2S,3S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxybutanedioate. InChIKey: RBBQYKCHZSUAPS-KBPBESRZSA-N.
| Molecular formula | C18H25NO7 |
|---|---|
| Molecular weight | 367.4 g/mol |
| IUPAC name | dimethyl (2S,3S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxybutanedioate |
| InChIKey | RBBQYKCHZSUAPS-KBPBESRZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]([C@@H](C(=O)OC)OCC1=CC=CC=C1)C(=O)OC |
Computed by PubChem (NCBI)