Products 20931-36-6
CAS 20931-36-6 appears in our catalog under these names: Neocryptomerin, Neocryptomerin, 99.14%, Neocryptomerin, ≥98%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 5mg, 5 mg, 1 mg, 10 mg, 10mg, 20mg.
5,7-dihydroxy-6-[4-(5-hydroxy-7-methoxy-4-oxochromen-2-yl)phenoxy]-2-(4-hydroxyphenyl)chromen-4-one (CAS 20931-36-6) is a chemical compound with the molecular formula C31H20O10 and a molecular weight of 552.5 g/mol. IUPAC name: 5,7-dihydroxy-6-[4-(5-hydroxy-7-methoxy-4-oxochromen-2-yl)phenoxy]-2-(4-hydroxyphenyl)chromen-4-one. InChIKey: YEMFTKDEHYFESW-UHFFFAOYSA-N.
| Molecular formula | C31H20O10 |
|---|---|
| Molecular weight | 552.5 g/mol |
| IUPAC name | 5,7-dihydroxy-6-[4-(5-hydroxy-7-methoxy-4-oxochromen-2-yl)phenoxy]-2-(4-hydroxyphenyl)chromen-4-one |
| InChIKey | YEMFTKDEHYFESW-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C2C(=C1)OC(=CC2=O)C3=CC=C(C=C3)OC4=C(C5=C(C=C4O)OC(=CC5=O)C6=CC=C(C=C6)O)O)O |
Computed by PubChem (NCBI)