Products 2093110-57-5
CAS 2093110-57-5 is the registry number for (S)-5,5'-(2-Methylpiperazine-1,4-diyl)diisophthalic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[(3S)-4-(3,5-dicarboxyphenyl)-3-methylpiperazin-1-yl]benzene-1,3-dicarboxylic acid (CAS 2093110-57-5) is a chemical compound with the molecular formula C21H20N2O8 and a molecular weight of 428.4 g/mol. IUPAC name: 5-[(3S)-4-(3,5-dicarboxyphenyl)-3-methylpiperazin-1-yl]benzene-1,3-dicarboxylic acid. InChIKey: QJDKJZRTSFSCQG-NSHDSACASA-N.
| Molecular formula | C21H20N2O8 |
|---|---|
| Molecular weight | 428.4 g/mol |
| IUPAC name | 5-[(3S)-4-(3,5-dicarboxyphenyl)-3-methylpiperazin-1-yl]benzene-1,3-dicarboxylic acid |
| InChIKey | QJDKJZRTSFSCQG-NSHDSACASA-N |
| SMILES | C[C@H]1CN(CCN1C2=CC(=CC(=C2)C(=O)O)C(=O)O)C3=CC(=CC(=C3)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)