CAS 2093154-00-6 appears in our catalog under these names: Propargyl-peg7-acid, 95%, Propargyl–PEG7–acid, 4,7,10,13,16,19,22-Heptaoxapentacos-24-ynoic acid, 98%, 98%, Propargyl-PEG7-acid, 98.0%, Propargyl-PEG7-acid, 98%. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 50mg, 250 mg, 100 mg, 1 g.
3-[2-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 2093154-00-6) is a chemical compound with the molecular formula C18H32O9 and a molecular weight of 392.4 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: VCXGERMSMMAGNQ-UHFFFAOYSA-N.
| Molecular formula | C18H32O9 |
|---|---|
| Molecular weight | 392.4 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | VCXGERMSMMAGNQ-UHFFFAOYSA-N |
| SMILES | C#CCOCCOCCOCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)