CAS 2093154-01-7 appears in our catalog under these names: N-Boc-n-bis(peg3-oh), 95%, N–Boc–N–bis(PEG4–OH), N-Boc-N-bis(PEG3-OH), N-Boc-n-bis(peg3-oh) 98%, 13-Hydroxy-2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]-5,8,11-trioxa-2-azatridecanoic acid 1,1-dimethylethyl ester, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 100mg, 500mg, 1000mg, 250 mg, 1 g, 25 mg.
Tert-butyl N,N-bis[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]carbamate (CAS 2093154-01-7) is a chemical compound with the molecular formula C21H43NO10 and a molecular weight of 469.6 g/mol. IUPAC name: tert-butyl N,N-bis[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]carbamate. InChIKey: KKRPLRNWLDABDZ-UHFFFAOYSA-N.
| Molecular formula | C21H43NO10 |
|---|---|
| Molecular weight | 469.6 g/mol |
| IUPAC name | tert-butyl N,N-bis[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]carbamate |
| InChIKey | KKRPLRNWLDABDZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(CCOCCOCCOCCO)CCOCCOCCOCCO |
Computed by PubChem (NCBI)