CAS 2093154-02-8 appears in our catalog under these names: N-Boc-n-bis(peg4-oh), 95%, N–Boc–N–bis–PEG5, N-Boc-N-bis-PEG5 95%, N-Boc-N-bis(PEG4-OH), 95%, 95%, N-Boc-N-bis-PEG5. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1g, 250mg, 100mg, 1 g, 250 mg, 100 mg.
Tert-butyl N,N-bis[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethyl]carbamate (CAS 2093154-02-8) is a chemical compound with the molecular formula C25H51NO12 and a molecular weight of 557.7 g/mol. IUPAC name: tert-butyl N,N-bis[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethyl]carbamate. InChIKey: ORLQQCLGZAXNLD-UHFFFAOYSA-N.
| Molecular formula | C25H51NO12 |
|---|---|
| Molecular weight | 557.7 g/mol |
| IUPAC name | tert-butyl N,N-bis[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethyl]carbamate |
| InChIKey | ORLQQCLGZAXNLD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(CCOCCOCCOCCOCCO)CCOCCOCCOCCOCCO |
Computed by PubChem (NCBI)